Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Tolylene 2,4-diisocyanate, 75%, technical
CAS: 584-84-9 Molecular Formula: C9H6N2O2 Molecular Weight (g/mol): 174.16 InChI Key: DVKJHBMWWAPEIU-UHFFFAOYSA-N Synonym: 2,4-toluene diisocyanate,2,4-diisocyanatotoluene,tolylene-2,4-diisocyanate,toluene-2,4-diisocyanate,2,4-tolylene diisocyanate,toluene 2,4-diisocyanate,4-methyl-m-phenylene diisocyanate,tolylene diisocyanate,2,4-tdi,toluylene-2,4-diisocyanate PubChem CID: 11443 ChEBI: CHEBI:53556 IUPAC Name: 2,4-diisocyanato-1-methylbenzene SMILES: CC1=C(C=C(C=C1)N=C=O)N=C=O
| PubChem CID | 11443 |
|---|---|
| CAS | 584-84-9 |
| Molecular Weight (g/mol) | 174.16 |
| ChEBI | CHEBI:53556 |
| SMILES | CC1=C(C=C(C=C1)N=C=O)N=C=O |
| Synonym | 2,4-toluene diisocyanate,2,4-diisocyanatotoluene,tolylene-2,4-diisocyanate,toluene-2,4-diisocyanate,2,4-tolylene diisocyanate,toluene 2,4-diisocyanate,4-methyl-m-phenylene diisocyanate,tolylene diisocyanate,2,4-tdi,toluylene-2,4-diisocyanate |
| IUPAC Name | 2,4-diisocyanato-1-methylbenzene |
| InChI Key | DVKJHBMWWAPEIU-UHFFFAOYSA-N |
| Molecular Formula | C9H6N2O2 |
Methylene di-p-phenyl diisocyanate, 98%, flakes
CAS: 101-68-8 Molecular Formula: C15H10N2O2 Molecular Weight (g/mol): 250.26 MDL Number: MFCD00036131 InChI Key: UPMLOUAZCHDJJD-UHFFFAOYSA-N Synonym: 4,4'-diphenylmethane diisocyanate,diphenylmethane diisocyanate,isonate,4,4'-diisocyanatodiphenylmethane,p,p'-diphenylmethane diisocyanate,bis 4-isocyanatophenyl methane,4,4'-methylenebis phenyl isocyanate,methylbisphenyl isocyanate,1,1'-methylenebis 4-isocyanatobenzene,methylene diphenyl diisocyanate PubChem CID: 7570 ChEBI: CHEBI:53218 IUPAC Name: 1-isocyanato-4-[(4-isocyanatophenyl)methyl]benzene SMILES: C1=CC(=CC=C1CC2=CC=C(C=C2)N=C=O)N=C=O
| PubChem CID | 7570 |
|---|---|
| CAS | 101-68-8 |
| Molecular Weight (g/mol) | 250.26 |
| ChEBI | CHEBI:53218 |
| MDL Number | MFCD00036131 |
| SMILES | C1=CC(=CC=C1CC2=CC=C(C=C2)N=C=O)N=C=O |
| Synonym | 4,4'-diphenylmethane diisocyanate,diphenylmethane diisocyanate,isonate,4,4'-diisocyanatodiphenylmethane,p,p'-diphenylmethane diisocyanate,bis 4-isocyanatophenyl methane,4,4'-methylenebis phenyl isocyanate,methylbisphenyl isocyanate,1,1'-methylenebis 4-isocyanatobenzene,methylene diphenyl diisocyanate |
| IUPAC Name | 1-isocyanato-4-[(4-isocyanatophenyl)methyl]benzene |
| InChI Key | UPMLOUAZCHDJJD-UHFFFAOYSA-N |
| Molecular Formula | C15H10N2O2 |
Sulforhodamine B sodium salt
CAS: 3520-42-1 Molecular Formula: C29H33N2NaO7S2 Molecular Weight (g/mol): 608.70 MDL Number: MFCD00010180 InChI Key: XJENLUNLXRJLEZ-UHFFFAOYSA-M Synonym: C.I. 45100; Kiton Red S PubChem CID: 131852807 IUPAC Name: 2-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]-5-sulfobenzenesulfonate;sodium SMILES: [Na+].CCN(CC)C1=CC2=[O+]C3=CC(N(CC)CC)=C(C)C=C3C(C3=CC=C(C=C3S([O-])(=O)=O)S([O-])(=O)=O)=C2C=C1C
| PubChem CID | 131852807 |
|---|---|
| CAS | 3520-42-1 |
| Molecular Weight (g/mol) | 608.70 |
| MDL Number | MFCD00010180 |
| SMILES | [Na+].CCN(CC)C1=CC2=[O+]C3=CC(N(CC)CC)=C(C)C=C3C(C3=CC=C(C=C3S([O-])(=O)=O)S([O-])(=O)=O)=C2C=C1C |
| Synonym | C.I. 45100; Kiton Red S |
| IUPAC Name | 2-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]-5-sulfobenzenesulfonate;sodium |
| InChI Key | XJENLUNLXRJLEZ-UHFFFAOYSA-M |
| Molecular Formula | C29H33N2NaO7S2 |
Hippuric acid, 98%
CAS: 495-69-2 Molecular Formula: C9H9NO3 Molecular Weight (g/mol): 179.18 MDL Number: MFCD00002692 InChI Key: QIAFMBKCNZACKA-UHFFFAOYSA-N Synonym: hippuric acid,n-benzoylglycine,glycine, n-benzoyl,benzoylglycine,benzamidoacetic acid,benzoylaminoacetic acid,hippurate,hippursaeure,phenylcarbonylaminoacetic acid,benzamidoessigsaeure PubChem CID: 464 ChEBI: CHEBI:18089 SMILES: OC(=O)CNC(=O)C1=CC=CC=C1
| PubChem CID | 464 |
|---|---|
| CAS | 495-69-2 |
| Molecular Weight (g/mol) | 179.18 |
| ChEBI | CHEBI:18089 |
| MDL Number | MFCD00002692 |
| SMILES | OC(=O)CNC(=O)C1=CC=CC=C1 |
| Synonym | hippuric acid,n-benzoylglycine,glycine, n-benzoyl,benzoylglycine,benzamidoacetic acid,benzoylaminoacetic acid,hippurate,hippursaeure,phenylcarbonylaminoacetic acid,benzamidoessigsaeure |
| InChI Key | QIAFMBKCNZACKA-UHFFFAOYSA-N |
| Molecular Formula | C9H9NO3 |
Biliverdin hydrochloride, Thermo Scientific Chemicals
CAS: 55482-27-4 Molecular Formula: C33H36Cl2N4O6 Molecular Weight (g/mol): 655.573 MDL Number: MFCD08669554 InChI Key: GNLHFBAZSKVVCQ-VTURHDOZSA-N Synonym: biliverdin hydrochloride PubChem CID: 132991794 IUPAC Name: 3-[(2Z)-2-[[3-(2-carboxyethyl)-5-[(E)-(3-ethenyl-4-methyl-5-oxopyrrol-2-ylidene)methyl]-4-methyl-1H-pyrrol-2-yl]methylidene]-5-[(4-ethenyl-3-methyl-5-oxopyrrol-2-yl)methylidene]-4-methylpyrrol-3-yl]propanoic acid;dihydrochloride SMILES: CC1=C(C(=CC2=C(C(=C(N2)C=C3C(=C(C(=O)N3)C)C=C)C)CCC(=O)O)NC1=CC4=NC(=O)C(=C4C)C=C)CCC(=O)O.Cl.Cl
| PubChem CID | 132991794 |
|---|---|
| CAS | 55482-27-4 |
| Molecular Weight (g/mol) | 655.573 |
| MDL Number | MFCD08669554 |
| SMILES | CC1=C(C(=CC2=C(C(=C(N2)C=C3C(=C(C(=O)N3)C)C=C)C)CCC(=O)O)NC1=CC4=NC(=O)C(=C4C)C=C)CCC(=O)O.Cl.Cl |
| Synonym | biliverdin hydrochloride |
| IUPAC Name | 3-[(2Z)-2-[[3-(2-carboxyethyl)-5-[(E)-(3-ethenyl-4-methyl-5-oxopyrrol-2-ylidene)methyl]-4-methyl-1H-pyrrol-2-yl]methylidene]-5-[(4-ethenyl-3-methyl-5-oxopyrrol-2-yl)methylidene]-4-methylpyrrol-3-yl]propanoic acid;dihydrochloride |
| InChI Key | GNLHFBAZSKVVCQ-VTURHDOZSA-N |
| Molecular Formula | C33H36Cl2N4O6 |
4-tert-Butyltoluene, 96%
CAS: 98-51-1 Molecular Formula: C11H16 Molecular Weight (g/mol): 148.25 MDL Number: MFCD00008837 InChI Key: QCWXDVFBZVHKLV-UHFFFAOYSA-N Synonym: 4-tert-butyltoluene,p-tert-butyltoluene,1-tert-butyl-4-methylbenzene,p-t-butyltoluene,benzene, 1-1,1-dimethylethyl-4-methyl,4-t-butyltoluene,p-methyl-tert-butylbenzene,toluene, p-tert-butyl,1-methyl-4-tert-butylbenzene,4-methyl-tert-butylbenzene PubChem CID: 7390 IUPAC Name: 1-tert-butyl-4-methylbenzene SMILES: CC1=CC=C(C=C1)C(C)(C)C
| PubChem CID | 7390 |
|---|---|
| CAS | 98-51-1 |
| Molecular Weight (g/mol) | 148.25 |
| MDL Number | MFCD00008837 |
| SMILES | CC1=CC=C(C=C1)C(C)(C)C |
| Synonym | 4-tert-butyltoluene,p-tert-butyltoluene,1-tert-butyl-4-methylbenzene,p-t-butyltoluene,benzene, 1-1,1-dimethylethyl-4-methyl,4-t-butyltoluene,p-methyl-tert-butylbenzene,toluene, p-tert-butyl,1-methyl-4-tert-butylbenzene,4-methyl-tert-butylbenzene |
| IUPAC Name | 1-tert-butyl-4-methylbenzene |
| InChI Key | QCWXDVFBZVHKLV-UHFFFAOYSA-N |
| Molecular Formula | C11H16 |
tert-Butyl bromide, 98+%, stab. with potassium carbonate
CAS: 507-19-7 Molecular Formula: C4H9Br Molecular Weight (g/mol): 137.02 MDL Number: MFCD00000125 InChI Key: RKSOPLXZQNSWAS-UHFFFAOYSA-N Synonym: tert-butyl bromide,t-butyl bromide,trimethylbromomethane,propane, 2-bromo-2-methyl,bromotrimethylmethane,2-bromoisobutane,tertiarybutyl bromide,tert-butylbromide,2-methyl-2-bromopropane,1-bromo-1,1-dimethylethane PubChem CID: 10485 IUPAC Name: 2-bromo-2-methylpropane SMILES: CC(C)(C)Br
| PubChem CID | 10485 |
|---|---|
| CAS | 507-19-7 |
| Molecular Weight (g/mol) | 137.02 |
| MDL Number | MFCD00000125 |
| SMILES | CC(C)(C)Br |
| Synonym | tert-butyl bromide,t-butyl bromide,trimethylbromomethane,propane, 2-bromo-2-methyl,bromotrimethylmethane,2-bromoisobutane,tertiarybutyl bromide,tert-butylbromide,2-methyl-2-bromopropane,1-bromo-1,1-dimethylethane |
| IUPAC Name | 2-bromo-2-methylpropane |
| InChI Key | RKSOPLXZQNSWAS-UHFFFAOYSA-N |
| Molecular Formula | C4H9Br |
Phenazine ethosulfate, ∽95%, MP Biomedicals™
CAS: 10510-77-7 Molecular Formula: C16H18N2O4S Molecular Weight (g/mol): 334.39 MDL Number: MFCD00050286 InChI Key: VDJKJPMLWJWQIH-UHFFFAOYSA-M Synonym: phenazine ethosulfate,5-ethylphenazine,n-ethylphenazonium ethosulfate,5-ethylphenazinium ethyl sulphate,5-ethylphenazin-5-ium ethyl sulfate,5-ethylphenazinium ethylsulfate,phenazinium, 5-ethyl-, ethyl sulfate,5-ethylphenazine, ethyl sulfate salt,ccris 5619,n-ethyldibenzopyrazine ethyl sulfate salt PubChem CID: 82688 IUPAC Name: 5-ethylphenazin-5-ium;ethyl sulfate SMILES: CC[N+]1=C2C=CC=CC2=NC3=CC=CC=C31.CCOS(=O)(=O)[O-]
| PubChem CID | 82688 |
|---|---|
| CAS | 10510-77-7 |
| Molecular Weight (g/mol) | 334.39 |
| MDL Number | MFCD00050286 |
| SMILES | CC[N+]1=C2C=CC=CC2=NC3=CC=CC=C31.CCOS(=O)(=O)[O-] |
| Synonym | phenazine ethosulfate,5-ethylphenazine,n-ethylphenazonium ethosulfate,5-ethylphenazinium ethyl sulphate,5-ethylphenazin-5-ium ethyl sulfate,5-ethylphenazinium ethylsulfate,phenazinium, 5-ethyl-, ethyl sulfate,5-ethylphenazine, ethyl sulfate salt,ccris 5619,n-ethyldibenzopyrazine ethyl sulfate salt |
| IUPAC Name | 5-ethylphenazin-5-ium;ethyl sulfate |
| InChI Key | VDJKJPMLWJWQIH-UHFFFAOYSA-M |
| Molecular Formula | C16H18N2O4S |
Diphenyl phosphite, contains varying amounts of phenol and (C6H5O)3P
CAS: 4712-55-4 Molecular Formula: C12H11O3P Molecular Weight (g/mol): 234.19 MDL Number: MFCD00044497 InChI Key: CDXVUROVRIFQMV-UHFFFAOYSA-N Synonym: diphenyl phosphite,diphenyl phosphonate,phosphonic acid, diphenyl ester,diphenoxyphosphine oxide,diphenyl hydrogen phosphite,phosphorous acid, diphenyl ester,unii-5144js6xum,phosphonic acid diphenyl ester,phenyl phosphonate, pho 2hpo,phenyl phosphonate pho 2hpo PubChem CID: 6327546 IUPAC Name: oxo(diphenoxy)phosphanium SMILES: C1=CC=C(C=C1)O[P+](=O)OC2=CC=CC=C2
| PubChem CID | 6327546 |
|---|---|
| CAS | 4712-55-4 |
| Molecular Weight (g/mol) | 234.19 |
| MDL Number | MFCD00044497 |
| SMILES | C1=CC=C(C=C1)O[P+](=O)OC2=CC=CC=C2 |
| Synonym | diphenyl phosphite,diphenyl phosphonate,phosphonic acid, diphenyl ester,diphenoxyphosphine oxide,diphenyl hydrogen phosphite,phosphorous acid, diphenyl ester,unii-5144js6xum,phosphonic acid diphenyl ester,phenyl phosphonate, pho 2hpo,phenyl phosphonate pho 2hpo |
| IUPAC Name | oxo(diphenoxy)phosphanium |
| InChI Key | CDXVUROVRIFQMV-UHFFFAOYSA-N |
| Molecular Formula | C12H11O3P |
| CAS | 9072-19-9 |
|---|---|
| MDL Number | 00131109 |
3-Hydroxy-2-butanone, monomer + dimer, 95%
CAS: 513-86-0 Molecular Formula: C4H8O2 Molecular Weight (g/mol): 88.11 MDL Number: MFCD00004521,MFCD00038696 InChI Key: ROWKJAVDOGWPAT-UHFFFAOYNA-N Synonym: acetoin,3-hydroxy-2-butanone,acetyl methyl carbinol,dimethylketol,2-butanone, 3-hydroxy,acetylmethylcarbinol,2,3-butanolone,2-hydroxy-3-butanone,1-hydroxyethyl methyl ketone,methanol, acetylmethyl PubChem CID: 179 ChEBI: CHEBI:15688 IUPAC Name: 3-hydroxybutan-2-one SMILES: CC(O)C(C)=O
| PubChem CID | 179 |
|---|---|
| CAS | 513-86-0 |
| Molecular Weight (g/mol) | 88.11 |
| ChEBI | CHEBI:15688 |
| MDL Number | MFCD00004521,MFCD00038696 |
| SMILES | CC(O)C(C)=O |
| Synonym | acetoin,3-hydroxy-2-butanone,acetyl methyl carbinol,dimethylketol,2-butanone, 3-hydroxy,acetylmethylcarbinol,2,3-butanolone,2-hydroxy-3-butanone,1-hydroxyethyl methyl ketone,methanol, acetylmethyl |
| IUPAC Name | 3-hydroxybutan-2-one |
| InChI Key | ROWKJAVDOGWPAT-UHFFFAOYNA-N |
| Molecular Formula | C4H8O2 |
L-Glutamic Acid 99.0+%, TCI America™
CAS: 56-86-0 Molecular Formula: C5H9NO4 Molecular Weight (g/mol): 147.13 MDL Number: MFCD00002634 InChI Key: WHUUTDBJXJRKMK-UHFFFAOYNA-N Synonym: l-glutamic acid,glutamic acid,2s-2-aminopentanedioic acid,h-glu-oh,s-2-aminopentanedioic acid,glutaminol,l-glutaminic acid,glutacid,glutamicol,glutamidex PubChem CID: 33032 ChEBI: CHEBI:16015 IUPAC Name: 2-aminopentanedioic acid SMILES: NC(CCC(O)=O)C(O)=O
| PubChem CID | 33032 |
|---|---|
| CAS | 56-86-0 |
| Molecular Weight (g/mol) | 147.13 |
| ChEBI | CHEBI:16015 |
| MDL Number | MFCD00002634 |
| SMILES | NC(CCC(O)=O)C(O)=O |
| Synonym | l-glutamic acid,glutamic acid,2s-2-aminopentanedioic acid,h-glu-oh,s-2-aminopentanedioic acid,glutaminol,l-glutaminic acid,glutacid,glutamicol,glutamidex |
| IUPAC Name | 2-aminopentanedioic acid |
| InChI Key | WHUUTDBJXJRKMK-UHFFFAOYNA-N |
| Molecular Formula | C5H9NO4 |
3-Isobutyl-1-Methylxanthine, MP Biomedicals™
CAS: 28822-58-4 Molecular Formula: C10H14N4O2 Molecular Weight (g/mol): 222.25 MDL Number: MFCD00005584 InChI Key: APIXJSLKIYYUKG-UHFFFAOYSA-N Synonym: 3-isobutyl-1-methylxanthine,ibmx,isobutylmethylxanthine,1-methyl-3-isobutylxanthine,methylisobutylxanthine,3-isobutyl-1-methyl-1h-purine-2,6 3h,7h-dione,xanthine, 3-isobutyl-1-methyl,3-isobutyl-1-methyxanthine,1h-purine-2,6-dione, 3,7-dihydro-1-methyl-3-2-methylpropyl,methyl-isobutylxanthine PubChem CID: 3758 ChEBI: CHEBI:43253 IUPAC Name: 1-methyl-3-(2-methylpropyl)-2,3,6,7-tetrahydro-1H-purine-2,6-dione SMILES: CC(C)CN1C2=C(NC=N2)C(=O)N(C)C1=O
| PubChem CID | 3758 |
|---|---|
| CAS | 28822-58-4 |
| Molecular Weight (g/mol) | 222.25 |
| ChEBI | CHEBI:43253 |
| MDL Number | MFCD00005584 |
| SMILES | CC(C)CN1C2=C(NC=N2)C(=O)N(C)C1=O |
| Synonym | 3-isobutyl-1-methylxanthine,ibmx,isobutylmethylxanthine,1-methyl-3-isobutylxanthine,methylisobutylxanthine,3-isobutyl-1-methyl-1h-purine-2,6 3h,7h-dione,xanthine, 3-isobutyl-1-methyl,3-isobutyl-1-methyxanthine,1h-purine-2,6-dione, 3,7-dihydro-1-methyl-3-2-methylpropyl,methyl-isobutylxanthine |
| IUPAC Name | 1-methyl-3-(2-methylpropyl)-2,3,6,7-tetrahydro-1H-purine-2,6-dione |
| InChI Key | APIXJSLKIYYUKG-UHFFFAOYSA-N |
| Molecular Formula | C10H14N4O2 |
Benzophenone, 99%
CAS: 119-61-9 Molecular Formula: C13H10O Molecular Weight (g/mol): 182.222 MDL Number: MFCD00003076 InChI Key: RWCCWEUUXYIKHB-UHFFFAOYSA-N Synonym: benzophenone,diphenyl ketone,benzoylbenzene,phenyl ketone,methanone, diphenyl,alpha-oxoditane,ketone, diphenyl,benzene, benzoyl,alpha-oxodiphenylmethane,diphenylketone PubChem CID: 3102 ChEBI: CHEBI:41308 IUPAC Name: diphenylmethanone SMILES: C1=CC=C(C=C1)C(=O)C2=CC=CC=C2
| PubChem CID | 3102 |
|---|---|
| CAS | 119-61-9 |
| Molecular Weight (g/mol) | 182.222 |
| ChEBI | CHEBI:41308 |
| MDL Number | MFCD00003076 |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=CC=C2 |
| Synonym | benzophenone,diphenyl ketone,benzoylbenzene,phenyl ketone,methanone, diphenyl,alpha-oxoditane,ketone, diphenyl,benzene, benzoyl,alpha-oxodiphenylmethane,diphenylketone |
| IUPAC Name | diphenylmethanone |
| InChI Key | RWCCWEUUXYIKHB-UHFFFAOYSA-N |
| Molecular Formula | C13H10O |
10-Phenylanthracene-9-boronic acid, 98%
CAS: 334658-75-2 Molecular Formula: C20H15BO2 Molecular Weight (g/mol): 298.15 MDL Number: MFCD11111989 InChI Key: RVPCPPWNSMAZKR-UHFFFAOYSA-N Synonym: 10-phenylanthracen-9-yl boronic acid,10-phenyl-9-anthracene boronic acid,10-phenyl-9-anthraceneboronic acid,10-phenylanthracene-9-boronic acid,10-phenylantrhacen-9-yl boronic acid,boronic acid, 10-phenyl-9-anthracenyl,pubchem19639,9-borono-10-phenylanthracene,10-phenylanthracene-9-ylboronic acid,10-phenyl-9-anthryl boronic acid PubChem CID: 22247164 IUPAC Name: (10-phenylanthracen-9-yl)boronic acid SMILES: OB(O)C1=C2C=CC=CC2=C(C2=CC=CC=C2)C2=CC=CC=C12
| PubChem CID | 22247164 |
|---|---|
| CAS | 334658-75-2 |
| Molecular Weight (g/mol) | 298.15 |
| MDL Number | MFCD11111989 |
| SMILES | OB(O)C1=C2C=CC=CC2=C(C2=CC=CC=C2)C2=CC=CC=C12 |
| Synonym | 10-phenylanthracen-9-yl boronic acid,10-phenyl-9-anthracene boronic acid,10-phenyl-9-anthraceneboronic acid,10-phenylanthracene-9-boronic acid,10-phenylantrhacen-9-yl boronic acid,boronic acid, 10-phenyl-9-anthracenyl,pubchem19639,9-borono-10-phenylanthracene,10-phenylanthracene-9-ylboronic acid,10-phenyl-9-anthryl boronic acid |
| IUPAC Name | (10-phenylanthracen-9-yl)boronic acid |
| InChI Key | RVPCPPWNSMAZKR-UHFFFAOYSA-N |
| Molecular Formula | C20H15BO2 |