Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Thiamphenicol, 98%, Thermo Scientific Chemicals
CAS: 15318-45-3 Molecular Formula: C12H15ClNO5S Molecular Weight (g/mol): 356.22 InChI Key: OTVAEFIXJLOWRX-NXEZZACHSA-N Synonym: thiamphenicol,thiophenicol,thiamcol,+-thiamphenicol,raceophenidol,thiocymetin,dextrosulphenidol,thiamphenicolum,d-thiocymetin,d-thiophenicol PubChem CID: 27200 ChEBI: CHEBI:32215 IUPAC Name: 2,2-dichloro-N-[(1R,2R)-1,3-dihydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]acetamide SMILES: CS(=O)(=O)C1=CC=C(C=C1)C(C(CO)NC(=O)C(Cl)Cl)O
| PubChem CID | 27200 |
|---|---|
| CAS | 15318-45-3 |
| Molecular Weight (g/mol) | 356.22 |
| ChEBI | CHEBI:32215 |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)C(C(CO)NC(=O)C(Cl)Cl)O |
| Synonym | thiamphenicol,thiophenicol,thiamcol,+-thiamphenicol,raceophenidol,thiocymetin,dextrosulphenidol,thiamphenicolum,d-thiocymetin,d-thiophenicol |
| IUPAC Name | 2,2-dichloro-N-[(1R,2R)-1,3-dihydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]acetamide |
| InChI Key | OTVAEFIXJLOWRX-NXEZZACHSA-N |
| Molecular Formula | C12H15ClNO5S |
1-(2-Pyridyl)piperazine, 98%
CAS: 34803-66-2 Molecular Formula: C9H13N3 Molecular Weight (g/mol): 163.22 InChI Key: GZRKXKUVVPSREJ-UHFFFAOYSA-N Synonym: 1-2-pyridyl piperazine,1-pyridin-2-yl piperazine,1-pyridin-2-yl-piperazine,1-2-pyridinyl piperazine,piperazine, 1-2-pyridinyl,2-pyridylpiperazine,pyridinylpiperazine,2-1-piperazinyl pyridine PubChem CID: 94459 IUPAC Name: 1-pyridin-2-ylpiperazine SMILES: C1CN(CCN1)C2=CC=CC=N2
| PubChem CID | 94459 |
|---|---|
| CAS | 34803-66-2 |
| Molecular Weight (g/mol) | 163.22 |
| SMILES | C1CN(CCN1)C2=CC=CC=N2 |
| Synonym | 1-2-pyridyl piperazine,1-pyridin-2-yl piperazine,1-pyridin-2-yl-piperazine,1-2-pyridinyl piperazine,piperazine, 1-2-pyridinyl,2-pyridylpiperazine,pyridinylpiperazine,2-1-piperazinyl pyridine |
| IUPAC Name | 1-pyridin-2-ylpiperazine |
| InChI Key | GZRKXKUVVPSREJ-UHFFFAOYSA-N |
| Molecular Formula | C9H13N3 |
trans-4-(Trifluoromethyl)cinnamic acid, 98%
CAS: 16642-92-5 Molecular Formula: C10H6F3O2 Molecular Weight (g/mol): 215.15 MDL Number: MFCD00002696 InChI Key: ANRMAUMHJREENI-ZZXKWVIFSA-M Synonym: 4-trifluoromethyl cinnamic acid,trans-4-trifluoromethyl cinnamic acid,p-trifluoromethyl cinnamic acid,e-3-4-trifluoromethyl phenyl acrylic acid,2e-3-4-trifluoromethyl phenyl prop-2-enoic acid,4-trifluoromethylcinnamic acid,2-propenoic acid, 3-4-trifluoromethyl phenyl,3-4-trifluoromethyl-phenyl-acrylic acid,ptf-cna,trans-4-trifluoromethylcinnamic acid PubChem CID: 688070 ChEBI: CHEBI:60705 IUPAC Name: (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoic acid SMILES: [O-]C(=O)\C=C\C1=CC=C(C=C1)C(F)(F)F
| PubChem CID | 688070 |
|---|---|
| CAS | 16642-92-5 |
| Molecular Weight (g/mol) | 215.15 |
| ChEBI | CHEBI:60705 |
| MDL Number | MFCD00002696 |
| SMILES | [O-]C(=O)\C=C\C1=CC=C(C=C1)C(F)(F)F |
| Synonym | 4-trifluoromethyl cinnamic acid,trans-4-trifluoromethyl cinnamic acid,p-trifluoromethyl cinnamic acid,e-3-4-trifluoromethyl phenyl acrylic acid,2e-3-4-trifluoromethyl phenyl prop-2-enoic acid,4-trifluoromethylcinnamic acid,2-propenoic acid, 3-4-trifluoromethyl phenyl,3-4-trifluoromethyl-phenyl-acrylic acid,ptf-cna,trans-4-trifluoromethylcinnamic acid |
| IUPAC Name | (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoic acid |
| InChI Key | ANRMAUMHJREENI-ZZXKWVIFSA-M |
| Molecular Formula | C10H6F3O2 |
Ethyl 2-mercaptoacetate, 99%
CAS: 623-51-8 Molecular Formula: C4H8O2S Molecular Weight (g/mol): 120.17 MDL Number: MFCD00004874 InChI Key: PVBRSNZAOAJRKO-UHFFFAOYSA-N Synonym: ethyl thioglycolate,ethyl mercaptoacetate,ethyl 2-mercaptoacetate,mercaptoacetic acid ethyl ester,ethyl thioglycollate,acetic acid, mercapto-, ethyl ester,thioglycolic acid ethyl ester,ethyl mercaptoacetic acid,usaf ek-2070,acetic acid, 2-mercapto-, ethyl ester PubChem CID: 12185 IUPAC Name: ethyl 2-sulfanylacetate SMILES: CCOC(=O)CS
| PubChem CID | 12185 |
|---|---|
| CAS | 623-51-8 |
| Molecular Weight (g/mol) | 120.17 |
| MDL Number | MFCD00004874 |
| SMILES | CCOC(=O)CS |
| Synonym | ethyl thioglycolate,ethyl mercaptoacetate,ethyl 2-mercaptoacetate,mercaptoacetic acid ethyl ester,ethyl thioglycollate,acetic acid, mercapto-, ethyl ester,thioglycolic acid ethyl ester,ethyl mercaptoacetic acid,usaf ek-2070,acetic acid, 2-mercapto-, ethyl ester |
| IUPAC Name | ethyl 2-sulfanylacetate |
| InChI Key | PVBRSNZAOAJRKO-UHFFFAOYSA-N |
| Molecular Formula | C4H8O2S |
Tetraethylammonium hydroxide, 20% aq. soln.
CAS: 77-98-5 Molecular Formula: C8H21NO Molecular Weight (g/mol): 147.26 MDL Number: MFCD00009024 InChI Key: LRGJRHZIDJQFCL-UHFFFAOYSA-M Synonym: tetraethylammonium hydroxide,tetraethyl ammonium hydroxide,unii-ra8vu41b1f,ammonium, tetraethyl-, hydroxide,tetraethylazanium hydroxide,ethanaminium, n,n,n-triethyl-, hydroxide,ra8vu41b1f,ethanaminium, n,n,n-triethyl-, hydroxide 1:1,tetraethylammonium hydroxide solution in water,n,n,n-triethylethanaminium PubChem CID: 6509 IUPAC Name: tetraethylazanium;hydroxide SMILES: [OH-].CC[N+](CC)(CC)CC
| PubChem CID | 6509 |
|---|---|
| CAS | 77-98-5 |
| Molecular Weight (g/mol) | 147.26 |
| MDL Number | MFCD00009024 |
| SMILES | [OH-].CC[N+](CC)(CC)CC |
| Synonym | tetraethylammonium hydroxide,tetraethyl ammonium hydroxide,unii-ra8vu41b1f,ammonium, tetraethyl-, hydroxide,tetraethylazanium hydroxide,ethanaminium, n,n,n-triethyl-, hydroxide,ra8vu41b1f,ethanaminium, n,n,n-triethyl-, hydroxide 1:1,tetraethylammonium hydroxide solution in water,n,n,n-triethylethanaminium |
| IUPAC Name | tetraethylazanium;hydroxide |
| InChI Key | LRGJRHZIDJQFCL-UHFFFAOYSA-M |
| Molecular Formula | C8H21NO |
Dichloroacetic Acid 98.0+%, TCI America™
CAS: 79-43-6 Molecular Formula: C2H2Cl2O2 Molecular Weight (g/mol): 128.936 MDL Number: MFCD00004223 InChI Key: JXTHNDFMNIQAHM-UHFFFAOYSA-N Synonym: dichloroacetic acid,dichloracetic acid,dichloroethanoic acid,acetic acid, dichloro,urner's liquid,dichlorethanoic acid,bichloracetic acid,dca acid,bichloroacetic acid,dichloro-acetic acid PubChem CID: 6597 ChEBI: CHEBI:36386 IUPAC Name: 2,2-dichloroacetic acid SMILES: C(C(=O)O)(Cl)Cl
| PubChem CID | 6597 |
|---|---|
| CAS | 79-43-6 |
| Molecular Weight (g/mol) | 128.936 |
| ChEBI | CHEBI:36386 |
| MDL Number | MFCD00004223 |
| SMILES | C(C(=O)O)(Cl)Cl |
| Synonym | dichloroacetic acid,dichloracetic acid,dichloroethanoic acid,acetic acid, dichloro,urner's liquid,dichlorethanoic acid,bichloracetic acid,dca acid,bichloroacetic acid,dichloro-acetic acid |
| IUPAC Name | 2,2-dichloroacetic acid |
| InChI Key | JXTHNDFMNIQAHM-UHFFFAOYSA-N |
| Molecular Formula | C2H2Cl2O2 |
Ethyl cyanoacetate, 98+%
CAS: 105-56-6 Molecular Formula: C5H7NO2 Molecular Weight (g/mol): 113.12 MDL Number: MFCD00001940 InChI Key: ZIUSEGSNTOUIPT-UHFFFAOYSA-N Synonym: ethyl cyanoacetate,ethyl cyanacetate,cyanoacetic acid ethyl ester,acetic acid, cyano-, ethyl ester,ethyl cyanoethanoate,cyanoacetic ester,cyanacetate ethyle,usaf kf-25,estere cianoacetico,ethyl cyano acetate PubChem CID: 7764 IUPAC Name: ethyl 2-cyanoacetate SMILES: CCOC(=O)CC#N
| PubChem CID | 7764 |
|---|---|
| CAS | 105-56-6 |
| Molecular Weight (g/mol) | 113.12 |
| MDL Number | MFCD00001940 |
| SMILES | CCOC(=O)CC#N |
| Synonym | ethyl cyanoacetate,ethyl cyanacetate,cyanoacetic acid ethyl ester,acetic acid, cyano-, ethyl ester,ethyl cyanoethanoate,cyanoacetic ester,cyanacetate ethyle,usaf kf-25,estere cianoacetico,ethyl cyano acetate |
| IUPAC Name | ethyl 2-cyanoacetate |
| InChI Key | ZIUSEGSNTOUIPT-UHFFFAOYSA-N |
| Molecular Formula | C5H7NO2 |
3-(N,N-Dimethylpalmitylammonio)propanesulfonate, 98%
CAS: 2281-11-0 Molecular Formula: C21H45NO3S Molecular Weight (g/mol): 391.66 MDL Number: MFCD00036911 InChI Key: TUBRCQBRKJXJEA-UHFFFAOYSA-N Synonym: 3-n,n-dimethylpalmitylammonio propanesulfonate,zwittergent 3-16,3-hexadecyldimethylammonio propane-1-sulfonate,palmityl sulfobetaine,n-hexadecyl-n,n-dimethyl-3-ammonio-1-propanesulfonate,3-hexadecyl dimethyl ammonio propane-1-sulfonate,3-palmityldimethylammonio propanesulfonate,3-hexadecyldimethylammonio propanesulfonate,3-n,n-dimethylhexadecylammonio propanesulfonate,n-hexadecy-n,n-dimethyl-3-ammonio-1-propanesulfonate PubChem CID: 92176 IUPAC Name: 3-[hexadecyl(dimethyl)azaniumyl]propane-1-sulfonate SMILES: CCCCCCCCCCCCCCCC[N+](C)(C)CCCS([O-])(=O)=O
| PubChem CID | 92176 |
|---|---|
| CAS | 2281-11-0 |
| Molecular Weight (g/mol) | 391.66 |
| MDL Number | MFCD00036911 |
| SMILES | CCCCCCCCCCCCCCCC[N+](C)(C)CCCS([O-])(=O)=O |
| Synonym | 3-n,n-dimethylpalmitylammonio propanesulfonate,zwittergent 3-16,3-hexadecyldimethylammonio propane-1-sulfonate,palmityl sulfobetaine,n-hexadecyl-n,n-dimethyl-3-ammonio-1-propanesulfonate,3-hexadecyl dimethyl ammonio propane-1-sulfonate,3-palmityldimethylammonio propanesulfonate,3-hexadecyldimethylammonio propanesulfonate,3-n,n-dimethylhexadecylammonio propanesulfonate,n-hexadecy-n,n-dimethyl-3-ammonio-1-propanesulfonate |
| IUPAC Name | 3-[hexadecyl(dimethyl)azaniumyl]propane-1-sulfonate |
| InChI Key | TUBRCQBRKJXJEA-UHFFFAOYSA-N |
| Molecular Formula | C21H45NO3S |
p-Toluenesulfonyl cyanide, 95%
CAS: 19158-51-1 Molecular Formula: C8H7NO2S Molecular Weight (g/mol): 181.21 InChI Key: JONIMGVUGJVFQD-UHFFFAOYSA-N Synonym: tosyl cyanide,p-toluenesulfonyl cyanide,4-methylbenzenesulfonyl cyanide,p-toluenesulphonyl cyanide,p-toluene sulfonyl cyanide,p-tolylsulfonyl cyanide,p-toluenesulfonylcyanide,benzenesulfonylcyanide, 4-methyl,benzenesulfonyl cyanide, 4-methyl,4-methylphenyl sulfonylformonitrile PubChem CID: 87946 IUPAC Name: (4-methylphenyl)sulfonylformonitrile SMILES: CC1=CC=C(C=C1)S(=O)(=O)C#N
| PubChem CID | 87946 |
|---|---|
| CAS | 19158-51-1 |
| Molecular Weight (g/mol) | 181.21 |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)C#N |
| Synonym | tosyl cyanide,p-toluenesulfonyl cyanide,4-methylbenzenesulfonyl cyanide,p-toluenesulphonyl cyanide,p-toluene sulfonyl cyanide,p-tolylsulfonyl cyanide,p-toluenesulfonylcyanide,benzenesulfonylcyanide, 4-methyl,benzenesulfonyl cyanide, 4-methyl,4-methylphenyl sulfonylformonitrile |
| IUPAC Name | (4-methylphenyl)sulfonylformonitrile |
| InChI Key | JONIMGVUGJVFQD-UHFFFAOYSA-N |
| Molecular Formula | C8H7NO2S |
Thermo Scientific Chemicals Resveratrol, 99%
CAS: 501-36-0 Molecular Formula: C14H12O3 Molecular Weight (g/mol): 228.24 MDL Number: MFCD00133799 InChI Key: LUKBXSAWLPMMSZ-OWOJBTEDSA-N Synonym: resveratrol,trans-resveratrol,3,4',5-trihydroxystilbene,3,5,4'-trihydroxystilbene,e-resveratrol,3,4',5-stilbenetriol,e-5-4-hydroxystyryl benzene-1,3-diol,resvida,3,4',5-trihydroxy-trans-stilbene,5-e-2-4-hydroxyphenyl ethenyl benzene-1,3-diol PubChem CID: 445154 ChEBI: CHEBI:45713 IUPAC Name: 5-[(E)-2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol SMILES: C1=CC(=CC=C1C=CC2=CC(=CC(=C2)O)O)O
| PubChem CID | 445154 |
|---|---|
| CAS | 501-36-0 |
| Molecular Weight (g/mol) | 228.24 |
| ChEBI | CHEBI:45713 |
| MDL Number | MFCD00133799 |
| SMILES | C1=CC(=CC=C1C=CC2=CC(=CC(=C2)O)O)O |
| Synonym | resveratrol,trans-resveratrol,3,4',5-trihydroxystilbene,3,5,4'-trihydroxystilbene,e-resveratrol,3,4',5-stilbenetriol,e-5-4-hydroxystyryl benzene-1,3-diol,resvida,3,4',5-trihydroxy-trans-stilbene,5-e-2-4-hydroxyphenyl ethenyl benzene-1,3-diol |
| IUPAC Name | 5-[(E)-2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol |
| InChI Key | LUKBXSAWLPMMSZ-OWOJBTEDSA-N |
| Molecular Formula | C14H12O3 |
Cyclopentane, HPLC Grade
CAS: 287-92-3 Molecular Formula: C5H10 Molecular Weight (g/mol): 70.135 MDL Number: MFCD00001356 InChI Key: RGSFGYAAUTVSQA-UHFFFAOYSA-N Synonym: pentamethylene,ciclopentano,cyclopentan,zyklopentan,unii-t86pb90rnu,hsdb 62,t86pb90rnu,cyclopentanes,cyclopentyl group,hydrocarbons, cyclic c5 and c6 PubChem CID: 9253 ChEBI: CHEBI:23492 IUPAC Name: cyclopentane SMILES: C1CCCC1
| PubChem CID | 9253 |
|---|---|
| CAS | 287-92-3 |
| Molecular Weight (g/mol) | 70.135 |
| ChEBI | CHEBI:23492 |
| MDL Number | MFCD00001356 |
| SMILES | C1CCCC1 |
| Synonym | pentamethylene,ciclopentano,cyclopentan,zyklopentan,unii-t86pb90rnu,hsdb 62,t86pb90rnu,cyclopentanes,cyclopentyl group,hydrocarbons, cyclic c5 and c6 |
| IUPAC Name | cyclopentane |
| InChI Key | RGSFGYAAUTVSQA-UHFFFAOYSA-N |
| Molecular Formula | C5H10 |
Tri-n-octylphosphine Oxide 95.0+%, TCI America™
Greener Choice
Offers one or more environmental benefits itemized in the U.S. FTC Green Guides.
Learn More
Offers one or more environmental benefits itemized in the U.S. FTC Green Guides.
Learn More
CAS: 78-50-2 Molecular Formula: C24H51OP Molecular Weight (g/mol): 386.645 MDL Number: MFCD00002083 InChI Key: ZMBHCYHQLYEYDV-UHFFFAOYSA-N Synonym: trioctylphosphine oxide,tri-n-octylphosphine oxide,topo,phosphine oxide, trioctyl,cyanex 921,hostarex px 324,trioctyl phosphine oxide,trioctylphosphane oxide,trioctylphosphino-1-one,acmc-209peg PubChem CID: 65577 IUPAC Name: 1-dioctylphosphoryloctane SMILES: CCCCCCCCP(=O)(CCCCCCCC)CCCCCCCC
| PubChem CID | 65577 |
|---|---|
| CAS | 78-50-2 |
| Molecular Weight (g/mol) | 386.645 |
| MDL Number | MFCD00002083 |
| SMILES | CCCCCCCCP(=O)(CCCCCCCC)CCCCCCCC |
| Synonym | trioctylphosphine oxide,tri-n-octylphosphine oxide,topo,phosphine oxide, trioctyl,cyanex 921,hostarex px 324,trioctyl phosphine oxide,trioctylphosphane oxide,trioctylphosphino-1-one,acmc-209peg |
| IUPAC Name | 1-dioctylphosphoryloctane |
| InChI Key | ZMBHCYHQLYEYDV-UHFFFAOYSA-N |
| Molecular Formula | C24H51OP |
Diphenylamine, ACS
CAS: 122-39-4 Molecular Formula: C12H11N Molecular Weight (g/mol): 169.227 MDL Number: MFCD00003014 InChI Key: DMBHHRLKUKUOEG-UHFFFAOYSA-N Synonym: diphenylamine,n-phenylbenzenamine,anilinobenzene,benzenamine, n-phenyl,n,n-diphenylamine,phenylaniline,scaldip,n-phenylbenzeneamine,big dipper,no-scald PubChem CID: 11487 ChEBI: CHEBI:4640 IUPAC Name: N-phenylaniline SMILES: C1=CC=C(C=C1)NC2=CC=CC=C2
| PubChem CID | 11487 |
|---|---|
| CAS | 122-39-4 |
| Molecular Weight (g/mol) | 169.227 |
| ChEBI | CHEBI:4640 |
| MDL Number | MFCD00003014 |
| SMILES | C1=CC=C(C=C1)NC2=CC=CC=C2 |
| Synonym | diphenylamine,n-phenylbenzenamine,anilinobenzene,benzenamine, n-phenyl,n,n-diphenylamine,phenylaniline,scaldip,n-phenylbenzeneamine,big dipper,no-scald |
| IUPAC Name | N-phenylaniline |
| InChI Key | DMBHHRLKUKUOEG-UHFFFAOYSA-N |
| Molecular Formula | C12H11N |
Citric acid, trisodium salt dihydrate, ACS reagent
CAS: 4-3-6132 Molecular Formula: C6H5Na3O7·2H2O Molecular Weight (g/mol): 294.09 InChI Key: NLJMYIDDQXHKNR-UHFFFAOYSA-K Synonym: trisodium citrate dihydrate,sodium citrate dihydrate,sodium citrate tribasic dihydrate,natriumcitrat-dihydrat,sodium citrate hydrate,1,2,3-propanetricarboxylic acid, 2-hydroxy-, trisodium salt, dihydrate,citronensaeure-tri-na-salz-dihydrat,citric acid trisodium salt dihydrate,citric acid, trisodium salt dihydrate,trisodium 2-hydroxypropane-1,2,3-tricarboxylate dihydrate PubChem CID: 71474 ChEBI: CHEBI:32142 IUPAC Name: trisodium;2-hydroxypropane-1,2,3-tricarboxylate;dihydrate SMILES: C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.O.O.[Na+].[Na+].[Na+]
| PubChem CID | 71474 |
|---|---|
| CAS | 4-3-6132 |
| Molecular Weight (g/mol) | 294.09 |
| ChEBI | CHEBI:32142 |
| SMILES | C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.O.O.[Na+].[Na+].[Na+] |
| Synonym | trisodium citrate dihydrate,sodium citrate dihydrate,sodium citrate tribasic dihydrate,natriumcitrat-dihydrat,sodium citrate hydrate,1,2,3-propanetricarboxylic acid, 2-hydroxy-, trisodium salt, dihydrate,citronensaeure-tri-na-salz-dihydrat,citric acid trisodium salt dihydrate,citric acid, trisodium salt dihydrate,trisodium 2-hydroxypropane-1,2,3-tricarboxylate dihydrate |
| IUPAC Name | trisodium;2-hydroxypropane-1,2,3-tricarboxylate;dihydrate |
| InChI Key | NLJMYIDDQXHKNR-UHFFFAOYSA-K |
| Molecular Formula | C6H5Na3O7·2H2O |
N-Ethylbenzylamine 97.0+%, TCI America™
CAS: 14321-27-8 Molecular Formula: C9H13N Molecular Weight (g/mol): 135.21 MDL Number: MFCD00009031 InChI Key: HVAAHUDGWQAAOJ-UHFFFAOYSA-N Synonym: n-ethylbenzylamine,benzenemethanamine, n-ethyl,ethylbenzylamine,n-benzylethylamine,benzyl ethyl amine,benzylamine, n-ethyl,benzylethylamine,unii-mm8324ke8v,n-benzyl-n-ethylamine,benzyl-ethyl-amine PubChem CID: 84352 IUPAC Name: N-benzylethanamine SMILES: CCNCC1=CC=CC=C1
| PubChem CID | 84352 |
|---|---|
| CAS | 14321-27-8 |
| Molecular Weight (g/mol) | 135.21 |
| MDL Number | MFCD00009031 |
| SMILES | CCNCC1=CC=CC=C1 |
| Synonym | n-ethylbenzylamine,benzenemethanamine, n-ethyl,ethylbenzylamine,n-benzylethylamine,benzyl ethyl amine,benzylamine, n-ethyl,benzylethylamine,unii-mm8324ke8v,n-benzyl-n-ethylamine,benzyl-ethyl-amine |
| IUPAC Name | N-benzylethanamine |
| InChI Key | HVAAHUDGWQAAOJ-UHFFFAOYSA-N |
| Molecular Formula | C9H13N |